About pentadec-8-yn-7-one
pentadec-8-yn-7-one (PubChem CID 10846701) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is pentadec-8-yn-7-one.
Molecular Properties
| Compound Name | pentadec-8-yn-7-one |
| PubChem CID | 10846701 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | pentadec-8-yn-7-one |
| SMILES | CCCCCCC#CC(=O)CCCCCC |
| InChI | InChI=1S/C15H26O/c1-3-5-7-9-10-12-14-15(16)13-11-8-6-4-2/h3-11,13H2,1-2H3 |
| InChIKey | CYJNMASHZKEWBU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pentadec-8-yn-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadec-8-yn-7-one?
The IUPAC name of pentadec-8-yn-7-one (CID 10846701) is pentadec-8-yn-7-one.
What is the SMILES notation for pentadec-8-yn-7-one?
The canonical SMILES for pentadec-8-yn-7-one is CCCCCCC#CC(=O)CCCCCC.
What is the InChIKey of pentadec-8-yn-7-one?
The InChIKey is CYJNMASHZKEWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O/c1-3-5-7-9-10-12-14-15(16)13-11-8-6-4-2/h3-11,13H2,1-2H3.
What are the key properties of pentadec-8-yn-7-one?
pentadec-8-yn-7-one has a molecular weight of 222.37 g/mol, XLogP of 4.50, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentadec-8-yn-7-one is sourced from PubChem (CID 10846701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).