About 10-oxohexadec-2-ynoic acid
10-oxohexadec-2-ynoic acid (PubChem CID 123950800) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is 10-oxohexadec-2-ynoic acid.
Molecular Properties
| Compound Name | 10-oxohexadec-2-ynoic acid |
| PubChem CID | 123950800 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 10-oxohexadec-2-ynoic acid |
| SMILES | CCCCCCC(=O)CCCCCCC#CC(=O)O |
| InChI | InChI=1S/C16H26O3/c1-2-3-4-9-12-15(17)13-10-7-5-6-8-11-14-16(18)19/h2-10,12-13H2,1H3,(H,18,19) |
| InChIKey | DGPBYPMERKRVLW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-oxohexadec-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-oxohexadec-2-ynoic acid?
The IUPAC name of 10-oxohexadec-2-ynoic acid (CID 123950800) is 10-oxohexadec-2-ynoic acid.
What is the SMILES notation for 10-oxohexadec-2-ynoic acid?
The canonical SMILES for 10-oxohexadec-2-ynoic acid is CCCCCCC(=O)CCCCCCC#CC(=O)O.
What is the InChIKey of 10-oxohexadec-2-ynoic acid?
The InChIKey is DGPBYPMERKRVLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3/c1-2-3-4-9-12-15(17)13-10-7-5-6-8-11-14-16(18)19/h2-10,12-13H2,1H3,(H,18,19).
What are the key properties of 10-oxohexadec-2-ynoic acid?
10-oxohexadec-2-ynoic acid has a molecular weight of 266.38 g/mol, XLogP of 3.95, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-oxohexadec-2-ynoic acid is sourced from PubChem (CID 123950800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).