About tetradec-7-yn-6-one
tetradec-7-yn-6-one (PubChem CID 12537067) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is tetradec-7-yn-6-one.
Molecular Properties
| Compound Name | tetradec-7-yn-6-one |
| PubChem CID | 12537067 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | tetradec-7-yn-6-one |
| SMILES | CCCCCCC#CC(=O)CCCCC |
| InChI | InChI=1S/C14H24O/c1-3-5-7-8-9-11-13-14(15)12-10-6-4-2/h3-10,12H2,1-2H3 |
| InChIKey | LUMWCVMGPWVUDJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tetradec-7-yn-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradec-7-yn-6-one?
The IUPAC name of tetradec-7-yn-6-one (CID 12537067) is tetradec-7-yn-6-one.
What is the SMILES notation for tetradec-7-yn-6-one?
The canonical SMILES for tetradec-7-yn-6-one is CCCCCCC#CC(=O)CCCCC.
What is the InChIKey of tetradec-7-yn-6-one?
The InChIKey is LUMWCVMGPWVUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O/c1-3-5-7-8-9-11-13-14(15)12-10-6-4-2/h3-10,12H2,1-2H3.
What are the key properties of tetradec-7-yn-6-one?
tetradec-7-yn-6-one has a molecular weight of 208.34 g/mol, XLogP of 4.11, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetradec-7-yn-6-one is sourced from PubChem (CID 12537067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).