About methyl 8-oxooctadec-9-ynoate
methyl 8-oxooctadec-9-ynoate (PubChem CID 71332554) has the molecular formula C19H32O3
and a molecular weight of 308.46 g/mol. Its IUPAC name is methyl 8-oxooctadec-9-ynoate.
Molecular Properties
| Compound Name | methyl 8-oxooctadec-9-ynoate |
| PubChem CID | 71332554 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | methyl 8-oxooctadec-9-ynoate |
| SMILES | CCCCCCCCC#CC(=O)CCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O3/c1-3-4-5-6-7-8-9-12-15-18(20)16-13-10-11-14-17-19(21)22-2/h3-11,13-14,16-17H2,1-2H3 |
| InChIKey | NLEWYDKBCGSSNV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-oxooctadec-9-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-oxooctadec-9-ynoate?
The IUPAC name of methyl 8-oxooctadec-9-ynoate (CID 71332554) is methyl 8-oxooctadec-9-ynoate.
What is the SMILES notation for methyl 8-oxooctadec-9-ynoate?
The canonical SMILES for methyl 8-oxooctadec-9-ynoate is CCCCCCCCC#CC(=O)CCCCCCC(=O)OC.
What is the InChIKey of methyl 8-oxooctadec-9-ynoate?
The InChIKey is NLEWYDKBCGSSNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O3/c1-3-4-5-6-7-8-9-12-15-18(20)16-13-10-11-14-17-19(21)22-2/h3-11,13-14,16-17H2,1-2H3.
What are the key properties of methyl 8-oxooctadec-9-ynoate?
methyl 8-oxooctadec-9-ynoate has a molecular weight of 308.46 g/mol, XLogP of 4.82, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-oxooctadec-9-ynoate is sourced from PubChem (CID 71332554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).