About heptadec-2-ynoic acid
heptadec-2-ynoic acid (PubChem CID 22600366) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is heptadec-2-ynoic acid.
Molecular Properties
| Compound Name | heptadec-2-ynoic acid |
| PubChem CID | 22600366 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | heptadec-2-ynoic acid |
| SMILES | CCCCCCCCCCCCCCC#CC(=O)O |
| InChI | InChI=1S/C17H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-14H2,1H3,(H,18,19) |
| InChIKey | VHVMWCWIYITOLN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze heptadec-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadec-2-ynoic acid?
The IUPAC name of heptadec-2-ynoic acid (CID 22600366) is heptadec-2-ynoic acid.
What is the SMILES notation for heptadec-2-ynoic acid?
The canonical SMILES for heptadec-2-ynoic acid is CCCCCCCCCCCCCCC#CC(=O)O.
What is the InChIKey of heptadec-2-ynoic acid?
The InChIKey is VHVMWCWIYITOLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-14H2,1H3,(H,18,19).
What are the key properties of heptadec-2-ynoic acid?
heptadec-2-ynoic acid has a molecular weight of 266.42 g/mol, XLogP of 5.17, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptadec-2-ynoic acid is sourced from PubChem (CID 22600366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).