About 3-oxoicosanenitrile
3-oxoicosanenitrile (PubChem CID 86112525) has the molecular formula C20H37NO
and a molecular weight of 307.52 g/mol. Its IUPAC name is 3-oxoicosanenitrile.
Molecular Properties
| Compound Name | 3-oxoicosanenitrile |
| PubChem CID | 86112525 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | 3-oxoicosanenitrile |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)CC#N |
| InChI | InChI=1S/C20H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)18-19-21/h2-18H2,1H3 |
| InChIKey | ZISBZWDXJCLDFA-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-oxoicosanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxoicosanenitrile?
The IUPAC name of 3-oxoicosanenitrile (CID 86112525) is 3-oxoicosanenitrile.
What is the SMILES notation for 3-oxoicosanenitrile?
The canonical SMILES for 3-oxoicosanenitrile is CCCCCCCCCCCCCCCCCC(=O)CC#N.
What is the InChIKey of 3-oxoicosanenitrile?
The InChIKey is ZISBZWDXJCLDFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)18-19-21/h2-18H2,1H3.
What are the key properties of 3-oxoicosanenitrile?
3-oxoicosanenitrile has a molecular weight of 307.52 g/mol, XLogP of 6.73, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxoicosanenitrile is sourced from PubChem (CID 86112525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).