About hexadec-1-yn-4-one
hexadec-1-yn-4-one (PubChem CID 170548739) has the molecular formula C16H28O
and a molecular weight of 236.40 g/mol. Its IUPAC name is hexadec-1-yn-4-one.
Molecular Properties
| Compound Name | hexadec-1-yn-4-one |
| PubChem CID | 170548739 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | hexadec-1-yn-4-one |
| SMILES | C#CCC(=O)CCCCCCCCCCCC |
| InChI | InChI=1S/C16H28O/c1-3-5-6-7-8-9-10-11-12-13-15-16(17)14-4-2/h2H,3,5-15H2,1H3 |
| InChIKey | DEVBEJVUFMBAKP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hexadec-1-yn-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadec-1-yn-4-one?
The IUPAC name of hexadec-1-yn-4-one (CID 170548739) is hexadec-1-yn-4-one.
What is the SMILES notation for hexadec-1-yn-4-one?
The canonical SMILES for hexadec-1-yn-4-one is C#CCC(=O)CCCCCCCCCCCC.
What is the InChIKey of hexadec-1-yn-4-one?
The InChIKey is DEVBEJVUFMBAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O/c1-3-5-6-7-8-9-10-11-12-13-15-16(17)14-4-2/h2H,3,5-15H2,1H3.
What are the key properties of hexadec-1-yn-4-one?
hexadec-1-yn-4-one has a molecular weight of 236.40 g/mol, XLogP of 4.89, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexadec-1-yn-4-one is sourced from PubChem (CID 170548739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).