About 4-oxododecanenitrile
4-oxododecanenitrile (PubChem CID 10943401) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-oxododecanenitrile.
Molecular Properties
| Compound Name | 4-oxododecanenitrile |
| PubChem CID | 10943401 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-oxododecanenitrile |
| SMILES | CCCCCCCCC(=O)CCC#N |
| InChI | InChI=1S/C12H21NO/c1-2-3-4-5-6-7-9-12(14)10-8-11-13/h2-10H2,1H3 |
| InChIKey | GQICXYXTMIDXNL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxododecanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxododecanenitrile?
The IUPAC name of 4-oxododecanenitrile (CID 10943401) is 4-oxododecanenitrile.
What is the SMILES notation for 4-oxododecanenitrile?
The canonical SMILES for 4-oxododecanenitrile is CCCCCCCCC(=O)CCC#N.
What is the InChIKey of 4-oxododecanenitrile?
The InChIKey is GQICXYXTMIDXNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-2-3-4-5-6-7-9-12(14)10-8-11-13/h2-10H2,1H3.
What are the key properties of 4-oxododecanenitrile?
4-oxododecanenitrile has a molecular weight of 195.31 g/mol, XLogP of 3.61, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxododecanenitrile is sourced from PubChem (CID 10943401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).