About heptan-2-imine;propane;tungsten
heptan-2-imine;propane;tungsten (PubChem CID 57359574) has the molecular formula C10H23NW
and a molecular weight of 341.14 g/mol. Its IUPAC name is heptan-2-imine;propane;tungsten.
Molecular Properties
| Compound Name | heptan-2-imine;propane;tungsten |
| PubChem CID | 57359574 |
| Molecular Formula | C10H23NW |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | heptan-2-imine;propane;tungsten |
| SMILES | CCC.[H]/N=C(\C)CCCCC.[W] |
| InChI | InChI=1S/C7H15N.C3H8.W/c1-3-4-5-6-7(2)8;1-3-2;/h8H,3-6H2,1-2H3;3H2,1-2H3;/b8-7+;; |
| InChIKey | XABQVFIAGAHIRX-MIIBGCIDSA-N |
| XLogP | 4.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-imine;propane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-imine;propane;tungsten?
The IUPAC name of heptan-2-imine;propane;tungsten (CID 57359574) is heptan-2-imine;propane;tungsten.
What is the SMILES notation for heptan-2-imine;propane;tungsten?
The canonical SMILES for heptan-2-imine;propane;tungsten is CCC.[H]/N=C(\C)CCCCC.[W].
What is the InChIKey of heptan-2-imine;propane;tungsten?
The InChIKey is XABQVFIAGAHIRX-MIIBGCIDSA-N. The full InChI is InChI=1S/C7H15N.C3H8.W/c1-3-4-5-6-7(2)8;1-3-2;/h8H,3-6H2,1-2H3;3H2,1-2H3;/b8-7+;;.
What are the key properties of heptan-2-imine;propane;tungsten?
heptan-2-imine;propane;tungsten has a molecular weight of 341.14 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-imine;propane;tungsten is sourced from PubChem (CID 57359574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).