C24H46N2O — CID 123699210
N-(13-iminotetradec-5-enyl)-N-propan-2-ylheptanamide (PubChem CID 123699210) has the molecular formula C24H46N2O and a molecular weight of 378.65 g/mol. Its IUPAC name is N-(13-iminotetradec-5-enyl)-N-propan-2-ylheptanamide.
| Compound Name | N-(13-iminotetradec-5-enyl)-N-propan-2-ylheptanamide |
|---|---|
| PubChem CID | 123699210 |
| Molecular Formula | C24H46N2O |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 378.36 |
| IUPAC Name | N-(13-iminotetradec-5-enyl)-N-propan-2-ylheptanamide |
| SMILES | [H]/N=C(\C)CCCCCCC=CCCCCN(C(=O)CCCCCC)C(C)C |
| InChI | InChI=1S/C24H46N2O/c1-5-6-7-17-20-24(27)26(22(2)3)21-18-15-13-11-9-8-10-12-14-16-19-23(4)25/h9,11,22,25H,5-8,10,12-21H2,1-4H3/b11-9?,25-23+ |
| InChIKey | AGTAPQQNALCNJJ-GIRKSRRCSA-N |
| XLogP | 7.30 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|