C23H45N3O2 — CID 123690894
N-(13-amino-13-hydroxyiminotridec-5-enyl)-N-propan-2-ylheptanamide (PubChem CID 123690894) has the molecular formula C23H45N3O2 and a molecular weight of 395.63 g/mol. Its IUPAC name is N-(13-amino-13-hydroxyiminotridec-5-enyl)-N-propan-2-ylheptanamide.
| Compound Name | N-(13-amino-13-hydroxyiminotridec-5-enyl)-N-propan-2-ylheptanamide |
|---|---|
| PubChem CID | 123690894 |
| Molecular Formula | C23H45N3O2 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.35 |
| IUPAC Name | N-(13-amino-13-hydroxyiminotridec-5-enyl)-N-propan-2-ylheptanamide |
| SMILES | CCCCCCC(=O)N(CCCCC=CCCCCCCC(N)=NO)C(C)C |
| InChI | InChI=1S/C23H45N3O2/c1-4-5-6-16-19-23(27)26(21(2)3)20-17-14-12-10-8-7-9-11-13-15-18-22(24)25-28/h8,10,21,28H,4-7,9,11-20H2,1-3H3,(H2,24,25) |
| InChIKey | QRMRQJAEGWZMBP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|