C24H43NO5 — CID 54276023
(2S)-2-[2-carboxyethyl(octadec-9-enoyl)amino]propanoic acid (PubChem CID 54276023) has the molecular formula C24H43NO5 and a molecular weight of 425.61 g/mol. Its IUPAC name is (2S)-2-[2-carboxyethyl(octadec-9-enoyl)amino]propanoic acid.
| Compound Name | (2S)-2-[2-carboxyethyl(octadec-9-enoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 54276023 |
| Molecular Formula | C24H43NO5 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | (2S)-2-[2-carboxyethyl(octadec-9-enoyl)amino]propanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N(CCC(=O)O)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C24H43NO5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(26)25(20-19-23(27)28)21(2)24(29)30/h10-11,21H,3-9,12-20H2,1-2H3,(H,27,28)(H,29,30)/t21-/m0/s1 |
| InChIKey | RNMHUZXRSXDPTM-NRFANRHFSA-N |
| XLogP | 5.80 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|