C19H37NO4 — CID 54563283
(2S)-2-[2-hydroxyethyl(tetradecanoyl)amino]propanoic acid (PubChem CID 54563283) has the molecular formula C19H37NO4 and a molecular weight of 343.51 g/mol. Its IUPAC name is (2S)-2-[2-hydroxyethyl(tetradecanoyl)amino]propanoic acid.
| Compound Name | (2S)-2-[2-hydroxyethyl(tetradecanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 54563283 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | (2S)-2-[2-hydroxyethyl(tetradecanoyl)amino]propanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)N(CCO)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C19H37NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-18(22)20(15-16-21)17(2)19(23)24/h17,21H,3-16H2,1-2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | ZSBDBQFVJMLNAQ-KRWDZBQOSA-N |
| XLogP | 3.98 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|