C19H36N4O3 — CID 123406959
N'-(13-amino-13-hydroxyiminotridec-5-enyl)-N-butyloxamide (PubChem CID 123406959) has the molecular formula C19H36N4O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is N'-(13-amino-13-hydroxyiminotridec-5-enyl)-N-butyloxamide.
| Compound Name | N'-(13-amino-13-hydroxyiminotridec-5-enyl)-N-butyloxamide |
|---|---|
| PubChem CID | 123406959 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | N'-(13-amino-13-hydroxyiminotridec-5-enyl)-N-butyloxamide |
| SMILES | CCCCNC(=O)C(=O)NCCCCC=CCCCCCCC(N)=NO |
| InChI | InChI=1S/C19H36N4O3/c1-2-3-15-21-18(24)19(25)22-16-13-11-9-7-5-4-6-8-10-12-14-17(20)23-26/h5,7,26H,2-4,6,8-16H2,1H3,(H2,20,23)(H,21,24)(H,22,25) |
| InChIKey | QMHISUILXLVNKK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|