C36H72N2O2 — CID 156747366
N-hexylhexadecanamide;(Z)-tetradec-9-enamide (PubChem CID 156747366) has the molecular formula C36H72N2O2 and a molecular weight of 564.98 g/mol. Its IUPAC name is N-hexylhexadecanamide;(Z)-tetradec-9-enamide.
| Compound Name | N-hexylhexadecanamide;(Z)-tetradec-9-enamide |
|---|---|
| PubChem CID | 156747366 |
| Molecular Formula | C36H72N2O2 |
| Molecular Weight | 564.98 g/mol |
| Exact Mass | 564.56 |
| IUPAC Name | N-hexylhexadecanamide;(Z)-tetradec-9-enamide |
| SMILES | CCCC/C=C\CCCCCCCC(N)=O.CCCCCCCCCCCCCCCC(=O)NCCCCCC |
| InChI | InChI=1S/C22H45NO.C14H27NO/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-20-22(24)23-21-19-8-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h3-21H2,1-2H3,(H,23,24);5-6H,2-4,7-13H2,1H3,(H2,15,16)/b;6-5- |
| InChIKey | FHAPJWQUXLWSSH-JXGYXAOLSA-N |
| XLogP | 11.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.98 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|