About N'-octylhexanediamide
N'-octylhexanediamide (PubChem CID 18377759) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is N'-octylhexanediamide.
Molecular Properties
| Compound Name | N'-octylhexanediamide |
| PubChem CID | 18377759 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | N'-octylhexanediamide |
| SMILES | CCCCCCCCNC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C14H28N2O2/c1-2-3-4-5-6-9-12-16-14(18)11-8-7-10-13(15)17/h2-12H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | NCUPDONBMBXZSQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-octylhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-octylhexanediamide?
The IUPAC name of N'-octylhexanediamide (CID 18377759) is N'-octylhexanediamide.
What is the SMILES notation for N'-octylhexanediamide?
The canonical SMILES for N'-octylhexanediamide is CCCCCCCCNC(=O)CCCCC(N)=O.
What is the InChIKey of N'-octylhexanediamide?
The InChIKey is NCUPDONBMBXZSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-2-3-4-5-6-9-12-16-14(18)11-8-7-10-13(15)17/h2-12H2,1H3,(H2,15,17)(H,16,18).
What are the key properties of N'-octylhexanediamide?
N'-octylhexanediamide has a molecular weight of 256.39 g/mol, XLogP of 2.51, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-octylhexanediamide is sourced from PubChem (CID 18377759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).