About N'-heptylundecanediamide;propanoic acid
N'-heptylundecanediamide;propanoic acid (PubChem CID 175230905) has the molecular formula C21H42N2O4
and a molecular weight of 386.58 g/mol. Its IUPAC name is N'-heptylundecanediamide;propanoic acid.
Molecular Properties
| Compound Name | N'-heptylundecanediamide;propanoic acid |
| PubChem CID | 175230905 |
| Molecular Formula | C21H42N2O4 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.31 |
| IUPAC Name | N'-heptylundecanediamide;propanoic acid |
| SMILES | CCC(=O)O.CCCCCCCNC(=O)CCCCCCCCCC(N)=O |
| InChI | InChI=1S/C18H36N2O2.C3H6O2/c1-2-3-4-10-13-16-20-18(22)15-12-9-7-5-6-8-11-14-17(19)21;1-2-3(4)5/h2-16H2,1H3,(H2,19,21)(H,20,22);2H2,1H3,(H,4,5) |
| InChIKey | BIVBBWPHFGMJSM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-heptylundecanediamide;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-heptylundecanediamide;propanoic acid?
The IUPAC name of N'-heptylundecanediamide;propanoic acid (CID 175230905) is N'-heptylundecanediamide;propanoic acid.
What is the SMILES notation for N'-heptylundecanediamide;propanoic acid?
The canonical SMILES for N'-heptylundecanediamide;propanoic acid is CCC(=O)O.CCCCCCCNC(=O)CCCCCCCCCC(N)=O.
What is the InChIKey of N'-heptylundecanediamide;propanoic acid?
The InChIKey is BIVBBWPHFGMJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2O2.C3H6O2/c1-2-3-4-10-13-16-20-18(22)15-12-9-7-5-6-8-11-14-17(19)21;1-2-3(4)5/h2-16H2,1H3,(H2,19,21)(H,20,22);2H2,1H3,(H,4,5).
What are the key properties of N'-heptylundecanediamide;propanoic acid?
N'-heptylundecanediamide;propanoic acid has a molecular weight of 386.58 g/mol, XLogP of 4.55, 17 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-heptylundecanediamide;propanoic acid is sourced from PubChem (CID 175230905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).