About N'-dodecylbutanediamide
N'-dodecylbutanediamide (PubChem CID 19973702) has the molecular formula C16H32N2O2
and a molecular weight of 284.44 g/mol. Its IUPAC name is N'-dodecylbutanediamide.
Molecular Properties
| Compound Name | N'-dodecylbutanediamide |
| PubChem CID | 19973702 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | N'-dodecylbutanediamide |
| SMILES | CCCCCCCCCCCCNC(=O)CCC(N)=O |
| InChI | InChI=1S/C16H32N2O2/c1-2-3-4-5-6-7-8-9-10-11-14-18-16(20)13-12-15(17)19/h2-14H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | JYNYGTPWIRTSGG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-dodecylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-dodecylbutanediamide?
The IUPAC name of N'-dodecylbutanediamide (CID 19973702) is N'-dodecylbutanediamide.
What is the SMILES notation for N'-dodecylbutanediamide?
The canonical SMILES for N'-dodecylbutanediamide is CCCCCCCCCCCCNC(=O)CCC(N)=O.
What is the InChIKey of N'-dodecylbutanediamide?
The InChIKey is JYNYGTPWIRTSGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2/c1-2-3-4-5-6-7-8-9-10-11-14-18-16(20)13-12-15(17)19/h2-14H2,1H3,(H2,17,19)(H,18,20).
What are the key properties of N'-dodecylbutanediamide?
N'-dodecylbutanediamide has a molecular weight of 284.44 g/mol, XLogP of 3.29, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-dodecylbutanediamide is sourced from PubChem (CID 19973702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).