About N'-butylbutanediamide
N'-butylbutanediamide (PubChem CID 12550556) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is N'-butylbutanediamide.
Molecular Properties
| Compound Name | N'-butylbutanediamide |
| PubChem CID | 12550556 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N'-butylbutanediamide |
| SMILES | CCCCNC(=O)CCC(N)=O |
| InChI | InChI=1S/C8H16N2O2/c1-2-3-6-10-8(12)5-4-7(9)11/h2-6H2,1H3,(H2,9,11)(H,10,12) |
| InChIKey | AKKLURFRSRACGV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-butylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butylbutanediamide?
The IUPAC name of N'-butylbutanediamide (CID 12550556) is N'-butylbutanediamide.
What is the SMILES notation for N'-butylbutanediamide?
The canonical SMILES for N'-butylbutanediamide is CCCCNC(=O)CCC(N)=O.
What is the InChIKey of N'-butylbutanediamide?
The InChIKey is AKKLURFRSRACGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-2-3-6-10-8(12)5-4-7(9)11/h2-6H2,1H3,(H2,9,11)(H,10,12).
What are the key properties of N'-butylbutanediamide?
N'-butylbutanediamide has a molecular weight of 172.23 g/mol, XLogP of 0.17, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butylbutanediamide is sourced from PubChem (CID 12550556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).