C23H40N2O2 — CID 75984794
14-[hexanoyl(propan-2-yl)amino]tetradeca-5,8,11-trienamide (PubChem CID 75984794) has the molecular formula C23H40N2O2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 14-[hexanoyl(propan-2-yl)amino]tetradeca-5,8,11-trienamide.
| Compound Name | 14-[hexanoyl(propan-2-yl)amino]tetradeca-5,8,11-trienamide |
|---|---|
| PubChem CID | 75984794 |
| Molecular Formula | C23H40N2O2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | 14-[hexanoyl(propan-2-yl)amino]tetradeca-5,8,11-trienamide |
| SMILES | CCCCCC(=O)N(CCC=CCC=CCC=CCCCC(N)=O)C(C)C |
| InChI | InChI=1S/C23H40N2O2/c1-4-5-15-19-23(27)25(21(2)3)20-17-14-12-10-8-6-7-9-11-13-16-18-22(24)26/h6,8-9,11-12,14,21H,4-5,7,10,13,15-20H2,1-3H3,(H2,24,26) |
| InChIKey | CWJVLMZVIOTHLW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|