C13H27N — CID 163570105
5,9-dimethylundecan-2-imine (PubChem CID 163570105) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is 5,9-dimethylundecan-2-imine.
| Compound Name | 5,9-dimethylundecan-2-imine |
|---|---|
| PubChem CID | 163570105 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 5,9-dimethylundecan-2-imine |
| SMILES | [H]/N=C(\C)CCC(C)CCCC(C)CC |
| InChI | InChI=1S/C13H27N/c1-5-11(2)7-6-8-12(3)9-10-13(4)14/h11-12,14H,5-10H2,1-4H3/b14-13+ |
| InChIKey | FYPDVLBTVIYYNL-BUHFOSPRSA-N |
| XLogP | 4.66 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|