About ethane;3-methylheptane;propan-2-imine
ethane;3-methylheptane;propan-2-imine (PubChem CID 142132474) has the molecular formula C13H31N
and a molecular weight of 201.40 g/mol. Its IUPAC name is ethane;3-methylheptane;propan-2-imine.
Molecular Properties
| Compound Name | ethane;3-methylheptane;propan-2-imine |
| PubChem CID | 142132474 |
| Molecular Formula | C13H31N |
| Molecular Weight | 201.40 g/mol |
| Exact Mass | 201.25 |
| IUPAC Name | ethane;3-methylheptane;propan-2-imine |
| SMILES | CC.CCCCC(C)CC.[H]N=C(C)C |
| InChI | InChI=1S/C8H18.C3H7N.C2H6/c1-4-6-7-8(3)5-2;1-3(2)4;1-2/h8H,4-7H2,1-3H3;4H,1-2H3;1-2H3 |
| InChIKey | RQKJXZUJQHRZEK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 201.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylheptane;propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylheptane;propan-2-imine?
The IUPAC name of ethane;3-methylheptane;propan-2-imine (CID 142132474) is ethane;3-methylheptane;propan-2-imine.
What is the SMILES notation for ethane;3-methylheptane;propan-2-imine?
The canonical SMILES for ethane;3-methylheptane;propan-2-imine is CC.CCCCC(C)CC.[H]N=C(C)C.
What is the InChIKey of ethane;3-methylheptane;propan-2-imine?
The InChIKey is RQKJXZUJQHRZEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C3H7N.C2H6/c1-4-6-7-8(3)5-2;1-3(2)4;1-2/h8H,4-7H2,1-3H3;4H,1-2H3;1-2H3.
What are the key properties of ethane;3-methylheptane;propan-2-imine?
ethane;3-methylheptane;propan-2-imine has a molecular weight of 201.40 g/mol, XLogP of 5.29, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylheptane;propan-2-imine is sourced from PubChem (CID 142132474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).