About 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane)
3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (PubChem CID 173302962) has the molecular formula C8H32O6P2S6
and a molecular weight of 478.69 g/mol. Its IUPAC name is 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
Molecular Properties
| Compound Name | 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| PubChem CID | 173302962 |
| Molecular Formula | C8H32O6P2S6 |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| SMILES | CCCCC(C)CC.OP(O)(O)=S.OP(O)(O)=S.S.S.S.S |
| InChI | InChI=1S/C8H18.2H3O3PS.4H2S/c1-4-6-7-8(3)5-2;2*1-4(2,3)5;;;;/h8H,4-7H2,1-3H3;2*(H3,1,2,3,5);4*1H2 |
| InChIKey | IJXYOZCDRHAYHE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The IUPAC name of 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (CID 173302962) is 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
What is the SMILES notation for 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The canonical SMILES for 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) is CCCCC(C)CC.OP(O)(O)=S.OP(O)(O)=S.S.S.S.S.
What is the InChIKey of 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The InChIKey is IJXYOZCDRHAYHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.2H3O3PS.4H2S/c1-4-6-7-8(3)5-2;2*1-4(2,3)5;;;;/h8H,4-7H2,1-3H3;2*(H3,1,2,3,5);4*1H2.
What are the key properties of 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) has a molecular weight of 478.69 g/mol, XLogP of 2.05, 4 rotatable bonds, 6 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptane;sulfane;bis(trihydroxy(sulfanylidene)-λ5-phosphane) is sourced from PubChem (CID 173302962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).