About 3-methylheptane;triethyl(methyl)azanium
3-methylheptane;triethyl(methyl)azanium (PubChem CID 155339140) has the molecular formula C15H36N+
and a molecular weight of 230.46 g/mol. Its IUPAC name is 3-methylheptane;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | 3-methylheptane;triethyl(methyl)azanium |
| PubChem CID | 155339140 |
| Molecular Formula | C15H36N+ |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.28 |
| IUPAC Name | 3-methylheptane;triethyl(methyl)azanium |
| SMILES | CCCCC(C)CC.CC[N+](C)(CC)CC |
| InChI | InChI=1S/C8H18.C7H18N/c1-4-6-7-8(3)5-2;1-5-8(4,6-2)7-3/h8H,4-7H2,1-3H3;5-7H2,1-4H3/q;+1 |
| InChIKey | FMELRAVBSBZLSE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylheptane;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylheptane;triethyl(methyl)azanium?
The IUPAC name of 3-methylheptane;triethyl(methyl)azanium (CID 155339140) is 3-methylheptane;triethyl(methyl)azanium.
What is the SMILES notation for 3-methylheptane;triethyl(methyl)azanium?
The canonical SMILES for 3-methylheptane;triethyl(methyl)azanium is CCCCC(C)CC.CC[N+](C)(CC)CC.
What is the InChIKey of 3-methylheptane;triethyl(methyl)azanium?
The InChIKey is FMELRAVBSBZLSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C7H18N/c1-4-6-7-8(3)5-2;1-5-8(4,6-2)7-3/h8H,4-7H2,1-3H3;5-7H2,1-4H3/q;+1.
What are the key properties of 3-methylheptane;triethyl(methyl)azanium?
3-methylheptane;triethyl(methyl)azanium has a molecular weight of 230.46 g/mol, XLogP of 4.72, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylheptane;triethyl(methyl)azanium is sourced from PubChem (CID 155339140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).