C12H26O — CID 121007505
(4R,8S)-4,8-dimethyldecan-1-ol (PubChem CID 121007505) has the molecular formula C12H26O and a molecular weight of 186.34 g/mol. Its IUPAC name is (4R,8S)-4,8-dimethyldecan-1-ol.
| Compound Name | (4R,8S)-4,8-dimethyldecan-1-ol |
|---|---|
| PubChem CID | 121007505 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | (4R,8S)-4,8-dimethyldecan-1-ol |
| SMILES | CC[C@H](C)CCC[C@@H](C)CCCO |
| InChI | InChI=1S/C12H26O/c1-4-11(2)7-5-8-12(3)9-6-10-13/h11-13H,4-10H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | QZKFSNSXOYRLSX-NWDGAFQWSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |