About 6,10-dimethyldodecan-2-one
6,10-dimethyldodecan-2-one (PubChem CID 14707953) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 6,10-dimethyldodecan-2-one.
Molecular Properties
| Compound Name | 6,10-dimethyldodecan-2-one |
| PubChem CID | 14707953 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 6,10-dimethyldodecan-2-one |
| SMILES | CCC(C)CCCC(C)CCCC(C)=O |
| InChI | InChI=1S/C14H28O/c1-5-12(2)8-6-9-13(3)10-7-11-14(4)15/h12-13H,5-11H2,1-4H3 |
| InChIKey | CVUJPEFABHFRBO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,10-dimethyldodecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10-dimethyldodecan-2-one?
The IUPAC name of 6,10-dimethyldodecan-2-one (CID 14707953) is 6,10-dimethyldodecan-2-one.
What is the SMILES notation for 6,10-dimethyldodecan-2-one?
The canonical SMILES for 6,10-dimethyldodecan-2-one is CCC(C)CCCC(C)CCCC(C)=O.
What is the InChIKey of 6,10-dimethyldodecan-2-one?
The InChIKey is CVUJPEFABHFRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-5-12(2)8-6-9-13(3)10-7-11-14(4)15/h12-13H,5-11H2,1-4H3.
What are the key properties of 6,10-dimethyldodecan-2-one?
6,10-dimethyldodecan-2-one has a molecular weight of 212.38 g/mol, XLogP of 4.60, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10-dimethyldodecan-2-one is sourced from PubChem (CID 14707953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).