About (6S)-6,10-dimethyltridecan-2-one
(6S)-6,10-dimethyltridecan-2-one (PubChem CID 87377837) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is (6S)-6,10-dimethyltridecan-2-one.
Molecular Properties
| Compound Name | (6S)-6,10-dimethyltridecan-2-one |
| PubChem CID | 87377837 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | (6S)-6,10-dimethyltridecan-2-one |
| SMILES | CCCC(C)CCC[C@H](C)CCCC(C)=O |
| InChI | InChI=1S/C15H30O/c1-5-8-13(2)9-6-10-14(3)11-7-12-15(4)16/h13-14H,5-12H2,1-4H3/t13?,14-/m0/s1 |
| InChIKey | JGXKQQXSKKTIOM-KZUDCZAMSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-6,10-dimethyltridecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6,10-dimethyltridecan-2-one?
The IUPAC name of (6S)-6,10-dimethyltridecan-2-one (CID 87377837) is (6S)-6,10-dimethyltridecan-2-one.
What is the SMILES notation for (6S)-6,10-dimethyltridecan-2-one?
The canonical SMILES for (6S)-6,10-dimethyltridecan-2-one is CCCC(C)CCC[C@H](C)CCCC(C)=O.
What is the InChIKey of (6S)-6,10-dimethyltridecan-2-one?
The InChIKey is JGXKQQXSKKTIOM-KZUDCZAMSA-N. The full InChI is InChI=1S/C15H30O/c1-5-8-13(2)9-6-10-14(3)11-7-12-15(4)16/h13-14H,5-12H2,1-4H3/t13?,14-/m0/s1.
What are the key properties of (6S)-6,10-dimethyltridecan-2-one?
(6S)-6,10-dimethyltridecan-2-one has a molecular weight of 226.40 g/mol, XLogP of 4.99, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6,10-dimethyltridecan-2-one is sourced from PubChem (CID 87377837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).