About 11,13-dimethylpentadecan-2-one
11,13-dimethylpentadecan-2-one (PubChem CID 88850025) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is 11,13-dimethylpentadecan-2-one.
Molecular Properties
| Compound Name | 11,13-dimethylpentadecan-2-one |
| PubChem CID | 88850025 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 11,13-dimethylpentadecan-2-one |
| SMILES | CCC(C)CC(C)CCCCCCCCC(C)=O |
| InChI | InChI=1S/C17H34O/c1-5-15(2)14-16(3)12-10-8-6-7-9-11-13-17(4)18/h15-16H,5-14H2,1-4H3 |
| InChIKey | YCHBGMHHWSAXMA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11,13-dimethylpentadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,13-dimethylpentadecan-2-one?
The IUPAC name of 11,13-dimethylpentadecan-2-one (CID 88850025) is 11,13-dimethylpentadecan-2-one.
What is the SMILES notation for 11,13-dimethylpentadecan-2-one?
The canonical SMILES for 11,13-dimethylpentadecan-2-one is CCC(C)CC(C)CCCCCCCCC(C)=O.
What is the InChIKey of 11,13-dimethylpentadecan-2-one?
The InChIKey is YCHBGMHHWSAXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O/c1-5-15(2)14-16(3)12-10-8-6-7-9-11-13-17(4)18/h15-16H,5-14H2,1-4H3.
What are the key properties of 11,13-dimethylpentadecan-2-one?
11,13-dimethylpentadecan-2-one has a molecular weight of 254.46 g/mol, XLogP of 5.77, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11,13-dimethylpentadecan-2-one is sourced from PubChem (CID 88850025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).