C18H36 — CID 123460821
3,5-dimethyl-10-methylidenepentadecane (PubChem CID 123460821) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 3,5-dimethyl-10-methylidenepentadecane.
| Compound Name | 3,5-dimethyl-10-methylidenepentadecane |
|---|---|
| PubChem CID | 123460821 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 3,5-dimethyl-10-methylidenepentadecane |
| SMILES | C=C(CCCCC)CCCCC(C)CC(C)CC |
| InChI | InChI=1S/C18H36/c1-6-8-9-12-17(4)13-10-11-14-18(5)15-16(3)7-2/h16,18H,4,6-15H2,1-3,5H3 |
| InChIKey | WCJNOLVGTWWZOH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|