C15H28O2 — CID 10966641
pentadecane-2,14-dione (PubChem CID 10966641) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is pentadecane-2,14-dione.
| Compound Name | pentadecane-2,14-dione |
|---|---|
| PubChem CID | 10966641 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | pentadecane-2,14-dione |
| SMILES | CC(=O)CCCCCCCCCCCC(C)=O |
| InChI | InChI=1S/C15H28O2/c1-14(16)12-10-8-6-4-3-5-7-9-11-13-15(2)17/h3-13H2,1-2H3 |
| InChIKey | VGTYPJUOACJSIR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|