About octan-2-one
octan-2-one (PubChem CID 123231388) has the molecular formula C8H15O+
and a molecular weight of 127.21 g/mol. Its IUPAC name is octan-2-one.
Molecular Properties
| Compound Name | octan-2-one |
| PubChem CID | 123231388 |
| Molecular Formula | C8H15O+ |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | octan-2-one |
| SMILES | [CH2+]CCCCCC(C)=O |
| InChI | InChI=1S/C8H15O/c1-3-4-5-6-7-8(2)9/h1,3-7H2,2H3/q+1 |
| InChIKey | DIVHHWJMVXACNE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze octan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-one?
The IUPAC name of octan-2-one (CID 123231388) is octan-2-one.
What is the SMILES notation for octan-2-one?
The canonical SMILES for octan-2-one is [CH2+]CCCCCC(C)=O.
What is the InChIKey of octan-2-one?
The InChIKey is DIVHHWJMVXACNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O/c1-3-4-5-6-7-8(2)9/h1,3-7H2,2H3/q+1.
What are the key properties of octan-2-one?
octan-2-one has a molecular weight of 127.21 g/mol, XLogP of 2.36, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-one is sourced from PubChem (CID 123231388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).