About 8,10-dimethylundecan-2-one
8,10-dimethylundecan-2-one (PubChem CID 90238828) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 8,10-dimethylundecan-2-one.
Molecular Properties
| Compound Name | 8,10-dimethylundecan-2-one |
| PubChem CID | 90238828 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 8,10-dimethylundecan-2-one |
| SMILES | CC(=O)CCCCCC(C)CC(C)C |
| InChI | InChI=1S/C13H26O/c1-11(2)10-12(3)8-6-5-7-9-13(4)14/h11-12H,5-10H2,1-4H3 |
| InChIKey | YMYIBSUJZWUHPF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8,10-dimethylundecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,10-dimethylundecan-2-one?
The IUPAC name of 8,10-dimethylundecan-2-one (CID 90238828) is 8,10-dimethylundecan-2-one.
What is the SMILES notation for 8,10-dimethylundecan-2-one?
The canonical SMILES for 8,10-dimethylundecan-2-one is CC(=O)CCCCCC(C)CC(C)C.
What is the InChIKey of 8,10-dimethylundecan-2-one?
The InChIKey is YMYIBSUJZWUHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O/c1-11(2)10-12(3)8-6-5-7-9-13(4)14/h11-12H,5-10H2,1-4H3.
What are the key properties of 8,10-dimethylundecan-2-one?
8,10-dimethylundecan-2-one has a molecular weight of 198.35 g/mol, XLogP of 4.21, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,10-dimethylundecan-2-one is sourced from PubChem (CID 90238828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).