About 18-methylnonadecan-2-one
18-methylnonadecan-2-one (PubChem CID 90921447) has the molecular formula C20H40O
and a molecular weight of 296.54 g/mol. Its IUPAC name is 18-methylnonadecan-2-one.
Molecular Properties
| Compound Name | 18-methylnonadecan-2-one |
| PubChem CID | 90921447 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 18-methylnonadecan-2-one |
| SMILES | CC(=O)CCCCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C20H40O/c1-19(2)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-20(3)21/h19H,4-18H2,1-3H3 |
| InChIKey | LFRGBJBOWXXUPT-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 18-methylnonadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18-methylnonadecan-2-one?
The IUPAC name of 18-methylnonadecan-2-one (CID 90921447) is 18-methylnonadecan-2-one.
What is the SMILES notation for 18-methylnonadecan-2-one?
The canonical SMILES for 18-methylnonadecan-2-one is CC(=O)CCCCCCCCCCCCCCCC(C)C.
What is the InChIKey of 18-methylnonadecan-2-one?
The InChIKey is LFRGBJBOWXXUPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O/c1-19(2)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-20(3)21/h19H,4-18H2,1-3H3.
What are the key properties of 18-methylnonadecan-2-one?
18-methylnonadecan-2-one has a molecular weight of 296.54 g/mol, XLogP of 7.08, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 18-methylnonadecan-2-one is sourced from PubChem (CID 90921447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).