About azane;16-methylheptadecanoic acid
azane;16-methylheptadecanoic acid (PubChem CID 161380406) has the molecular formula C18H39NO2
and a molecular weight of 301.52 g/mol. Its IUPAC name is azane;16-methylheptadecanoic acid.
Molecular Properties
| Compound Name | azane;16-methylheptadecanoic acid |
| PubChem CID | 161380406 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | azane;16-methylheptadecanoic acid |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)O.N |
| InChI | InChI=1S/C18H36O2.H3N/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;/h17H,3-16H2,1-2H3,(H,19,20);1H3 |
| InChIKey | VRQJZPICRKOLGS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;16-methylheptadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;16-methylheptadecanoic acid?
The IUPAC name of azane;16-methylheptadecanoic acid (CID 161380406) is azane;16-methylheptadecanoic acid.
What is the SMILES notation for azane;16-methylheptadecanoic acid?
The canonical SMILES for azane;16-methylheptadecanoic acid is CC(C)CCCCCCCCCCCCCCC(=O)O.N.
What is the InChIKey of azane;16-methylheptadecanoic acid?
The InChIKey is VRQJZPICRKOLGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.H3N/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;/h17H,3-16H2,1-2H3,(H,19,20);1H3.
What are the key properties of azane;16-methylheptadecanoic acid?
azane;16-methylheptadecanoic acid has a molecular weight of 301.52 g/mol, XLogP of 6.35, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;16-methylheptadecanoic acid is sourced from PubChem (CID 161380406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).