C20H40O2 — CID 123475021
12,17-dimethyloctadecanoic acid (PubChem CID 123475021) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 12,17-dimethyloctadecanoic acid.
| Compound Name | 12,17-dimethyloctadecanoic acid |
|---|---|
| PubChem CID | 123475021 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 12,17-dimethyloctadecanoic acid |
| SMILES | CC(C)CCCCC(C)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H40O2/c1-18(2)14-12-13-16-19(3)15-10-8-6-4-5-7-9-11-17-20(21)22/h18-19H,4-17H2,1-3H3,(H,21,22) |
| InChIKey | PWMANHFLJHZJJA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|