About 4-methylhexadecanedioic acid;dihydrochloride
4-methylhexadecanedioic acid;dihydrochloride (PubChem CID 89463142) has the molecular formula C17H34Cl2O4
and a molecular weight of 373.36 g/mol. Its IUPAC name is 4-methylhexadecanedioic acid;dihydrochloride.
Molecular Properties
| Compound Name | 4-methylhexadecanedioic acid;dihydrochloride |
| PubChem CID | 89463142 |
| Molecular Formula | C17H34Cl2O4 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-methylhexadecanedioic acid;dihydrochloride |
| SMILES | CC(CCCCCCCCCCCC(=O)O)CCC(=O)O.Cl.Cl |
| InChI | InChI=1S/C17H32O4.2ClH/c1-15(13-14-17(20)21)11-9-7-5-3-2-4-6-8-10-12-16(18)19;;/h15H,2-14H2,1H3,(H,18,19)(H,20,21);2*1H |
| InChIKey | WDYCUGKEIQMTSY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylhexadecanedioic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylhexadecanedioic acid;dihydrochloride?
The IUPAC name of 4-methylhexadecanedioic acid;dihydrochloride (CID 89463142) is 4-methylhexadecanedioic acid;dihydrochloride.
What is the SMILES notation for 4-methylhexadecanedioic acid;dihydrochloride?
The canonical SMILES for 4-methylhexadecanedioic acid;dihydrochloride is CC(CCCCCCCCCCCC(=O)O)CCC(=O)O.Cl.Cl.
What is the InChIKey of 4-methylhexadecanedioic acid;dihydrochloride?
The InChIKey is WDYCUGKEIQMTSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O4.2ClH/c1-15(13-14-17(20)21)11-9-7-5-3-2-4-6-8-10-12-16(18)19;;/h15H,2-14H2,1H3,(H,18,19)(H,20,21);2*1H.
What are the key properties of 4-methylhexadecanedioic acid;dihydrochloride?
4-methylhexadecanedioic acid;dihydrochloride has a molecular weight of 373.36 g/mol, XLogP of 5.71, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylhexadecanedioic acid;dihydrochloride is sourced from PubChem (CID 89463142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).