copper;6-methylheptanoic acid;7-methyloctanoic acid

C17H34CuO4 — CID 170842842

IUPACcopper;6-methylheptanoic acid;7-methyloctanoic acid
SMILESCC(C)CCCCC(=O)O.CC(C)CCCCCC(=O)O.[Cu]
InChIInChI=1S/C9H18O2.C8H16O2.Cu/c1-8(2)6-4-3-5-7-9(10)11;1-7(2)5-3-4-6-8(9)10;/h8H,3-7H2,1-2H3,(H,10,11);7H,3-6H2,1-2H3,(H,9,10);
InChIKeyRNYNBMIDHCNNLL-UHFFFAOYSA-N
MW366.00 g/mol
LogP4.96
Rot. Bonds11

About copper;6-methylheptanoic acid;7-methyloctanoic acid

copper;6-methylheptanoic acid;7-methyloctanoic acid (PubChem CID 170842842) has the molecular formula C17H34CuO4 and a molecular weight of 366.00 g/mol. Its IUPAC name is copper;6-methylheptanoic acid;7-methyloctanoic acid.

Molecular Properties

Compound Namecopper;6-methylheptanoic acid;7-methyloctanoic acid
PubChem CID170842842
Molecular FormulaC17H34CuO4
Molecular Weight366.00 g/mol
Exact Mass365.18
IUPAC Namecopper;6-methylheptanoic acid;7-methyloctanoic acid
SMILESCC(C)CCCCC(=O)O.CC(C)CCCCCC(=O)O.[Cu]
InChIInChI=1S/C9H18O2.C8H16O2.Cu/c1-8(2)6-4-3-5-7-9(10)11;1-7(2)5-3-4-6-8(9)10;/h8H,3-7H2,1-2H3,(H,10,11);7H,3-6H2,1-2H3,(H,9,10);
InChIKeyRNYNBMIDHCNNLL-UHFFFAOYSA-N
XLogP4.96
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds11
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.00
LogP ≤ 54.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze copper;6-methylheptanoic acid;7-methyloctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

16-methylheptadecanoic acid
CID 87200881
azane;16-methylheptadecanoic acid
CID 161380406
8-methylnonanoic acid;zinc
CID 175431403
iron;6-methylheptanoic acid;7-methyloctanoic acid
CID 56844011
λ2-plumbane;6-methylheptanoic acid
CID 175289081
6-methylheptanoic acid;vanadium
CID 174623955
gadolinium;tris(6-methylheptanoic acid)
CID 176895771
12,17-dimethyloctadecanoic acid
CID 123475021
methoxymethane;16-methylheptadecanoic acid
CID 175921970
sodium;hydride;6-methylheptanoic acid
CID 174475906
7-methyloctanoic acid;nonanoic acid
CID 159973040
8,12-dimethyltridecanoic acid
CID 101005175

Frequently Asked Questions

What is the IUPAC name of copper;6-methylheptanoic acid;7-methyloctanoic acid?
The IUPAC name of copper;6-methylheptanoic acid;7-methyloctanoic acid (CID 170842842) is copper;6-methylheptanoic acid;7-methyloctanoic acid.
What is the SMILES notation for copper;6-methylheptanoic acid;7-methyloctanoic acid?
The canonical SMILES for copper;6-methylheptanoic acid;7-methyloctanoic acid is CC(C)CCCCC(=O)O.CC(C)CCCCCC(=O)O.[Cu].
What is the InChIKey of copper;6-methylheptanoic acid;7-methyloctanoic acid?
The InChIKey is RNYNBMIDHCNNLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.C8H16O2.Cu/c1-8(2)6-4-3-5-7-9(10)11;1-7(2)5-3-4-6-8(9)10;/h8H,3-7H2,1-2H3,(H,10,11);7H,3-6H2,1-2H3,(H,9,10);.
What are the key properties of copper;6-methylheptanoic acid;7-methyloctanoic acid?
copper;6-methylheptanoic acid;7-methyloctanoic acid has a molecular weight of 366.00 g/mol, XLogP of 4.96, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;6-methylheptanoic acid;7-methyloctanoic acid is sourced from PubChem (CID 170842842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).