C18H36O4 — CID 159973040
7-methyloctanoic acid;nonanoic acid (PubChem CID 159973040) has the molecular formula C18H36O4 and a molecular weight of 316.48 g/mol. Its IUPAC name is 7-methyloctanoic acid;nonanoic acid.
| Compound Name | 7-methyloctanoic acid;nonanoic acid |
|---|---|
| PubChem CID | 159973040 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 7-methyloctanoic acid;nonanoic acid |
| SMILES | CC(C)CCCCCC(=O)O.CCCCCCCCC(=O)O |
| InChI | InChI=1S/2C9H18O2/c1-8(2)6-4-3-5-7-9(10)11;1-2-3-4-5-6-7-8-9(10)11/h8H,3-7H2,1-2H3,(H,10,11);2-8H2,1H3,(H,10,11) |
| InChIKey | OEUMGHFRQCDSAA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|