About 4-methylpentanoic acid;octanoic acid
4-methylpentanoic acid;octanoic acid (PubChem CID 88696485) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is 4-methylpentanoic acid;octanoic acid.
Molecular Properties
| Compound Name | 4-methylpentanoic acid;octanoic acid |
| PubChem CID | 88696485 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 4-methylpentanoic acid;octanoic acid |
| SMILES | CC(C)CCC(=O)O.CCCCCCCC(=O)O |
| InChI | InChI=1S/C8H16O2.C6H12O2/c1-2-3-4-5-6-7-8(9)10;1-5(2)3-4-6(7)8/h2-7H2,1H3,(H,9,10);5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | XPMGETDGAXRQAG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentanoic acid;octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentanoic acid;octanoic acid?
The IUPAC name of 4-methylpentanoic acid;octanoic acid (CID 88696485) is 4-methylpentanoic acid;octanoic acid.
What is the SMILES notation for 4-methylpentanoic acid;octanoic acid?
The canonical SMILES for 4-methylpentanoic acid;octanoic acid is CC(C)CCC(=O)O.CCCCCCCC(=O)O.
What is the InChIKey of 4-methylpentanoic acid;octanoic acid?
The InChIKey is XPMGETDGAXRQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C6H12O2/c1-2-3-4-5-6-7-8(9)10;1-5(2)3-4-6(7)8/h2-7H2,1H3,(H,9,10);5H,3-4H2,1-2H3,(H,7,8).
What are the key properties of 4-methylpentanoic acid;octanoic acid?
4-methylpentanoic acid;octanoic acid has a molecular weight of 260.37 g/mol, XLogP of 3.94, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentanoic acid;octanoic acid is sourced from PubChem (CID 88696485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).