About (813C)octadecanoic acid
(813C)octadecanoic acid (PubChem CID 171379166) has the molecular formula C18H36O2
and a molecular weight of 285.48 g/mol. Its IUPAC name is (813C)octadecanoic acid.
Molecular Properties
| Compound Name | (813C)octadecanoic acid |
| PubChem CID | 171379166 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | (813C)octadecanoic acid |
| SMILES | CCCCCCCCCC[13CH2]CCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/i11+1 |
| InChIKey | QIQXTHQIDYTFRH-KHWBWMQUSA-N |
| XLogP | 6.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (813C)octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (813C)octadecanoic acid?
The IUPAC name of (813C)octadecanoic acid (CID 171379166) is (813C)octadecanoic acid.
What is the SMILES notation for (813C)octadecanoic acid?
The canonical SMILES for (813C)octadecanoic acid is CCCCCCCCCC[13CH2]CCCCCCC(=O)O.
What is the InChIKey of (813C)octadecanoic acid?
The InChIKey is QIQXTHQIDYTFRH-KHWBWMQUSA-N. The full InChI is InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/i11+1.
What are the key properties of (813C)octadecanoic acid?
(813C)octadecanoic acid has a molecular weight of 285.48 g/mol, XLogP of 6.33, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (813C)octadecanoic acid is sourced from PubChem (CID 171379166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).