About icosan-9-ol;16-methylheptadecanoic acid
icosan-9-ol;16-methylheptadecanoic acid (PubChem CID 159681900) has the molecular formula C38H78O3
and a molecular weight of 583.04 g/mol. Its IUPAC name is icosan-9-ol;16-methylheptadecanoic acid.
Molecular Properties
| Compound Name | icosan-9-ol;16-methylheptadecanoic acid |
| PubChem CID | 159681900 |
| Molecular Formula | C38H78O3 |
| Molecular Weight | 583.04 g/mol |
| Exact Mass | 582.60 |
| IUPAC Name | icosan-9-ol;16-methylheptadecanoic acid |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCC(O)CCCCCCCC |
| InChI | InChI=1S/C20H42O.C18H36O2/c1-3-5-7-9-11-12-13-15-17-19-20(21)18-16-14-10-8-6-4-2;1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20/h20-21H,3-19H2,1-2H3;17H,3-16H2,1-2H3,(H,19,20) |
| InChIKey | MVHUDFCTKBLIIX-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 583.04 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze icosan-9-ol;16-methylheptadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icosan-9-ol;16-methylheptadecanoic acid?
The IUPAC name of icosan-9-ol;16-methylheptadecanoic acid (CID 159681900) is icosan-9-ol;16-methylheptadecanoic acid.
What is the SMILES notation for icosan-9-ol;16-methylheptadecanoic acid?
The canonical SMILES for icosan-9-ol;16-methylheptadecanoic acid is CC(C)CCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCC(O)CCCCCCCC.
What is the InChIKey of icosan-9-ol;16-methylheptadecanoic acid?
The InChIKey is MVHUDFCTKBLIIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O.C18H36O2/c1-3-5-7-9-11-12-13-15-17-19-20(21)18-16-14-10-8-6-4-2;1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20/h20-21H,3-19H2,1-2H3;17H,3-16H2,1-2H3,(H,19,20).
What are the key properties of icosan-9-ol;16-methylheptadecanoic acid?
icosan-9-ol;16-methylheptadecanoic acid has a molecular weight of 583.04 g/mol, XLogP of 13.21, 32 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for icosan-9-ol;16-methylheptadecanoic acid is sourced from PubChem (CID 159681900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).