About octane;octanoic acid
octane;octanoic acid (PubChem CID 88924420) has the molecular formula C16H34O2
and a molecular weight of 258.45 g/mol. Its IUPAC name is octane;octanoic acid.
Molecular Properties
| Compound Name | octane;octanoic acid |
| PubChem CID | 88924420 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | octane;octanoic acid |
| SMILES | CCCCCCCC.CCCCCCCC(=O)O |
| InChI | InChI=1S/C8H16O2.C8H18/c1-2-3-4-5-6-7-8(9)10;1-3-5-7-8-6-4-2/h2-7H2,1H3,(H,9,10);3-8H2,1-2H3 |
| InChIKey | RWLCRGFRVNYGSR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octane;octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane;octanoic acid?
The IUPAC name of octane;octanoic acid (CID 88924420) is octane;octanoic acid.
What is the SMILES notation for octane;octanoic acid?
The canonical SMILES for octane;octanoic acid is CCCCCCCC.CCCCCCCC(=O)O.
What is the InChIKey of octane;octanoic acid?
The InChIKey is RWLCRGFRVNYGSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C8H18/c1-2-3-4-5-6-7-8(9)10;1-3-5-7-8-6-4-2/h2-7H2,1H3,(H,9,10);3-8H2,1-2H3.
What are the key properties of octane;octanoic acid?
octane;octanoic acid has a molecular weight of 258.45 g/mol, XLogP of 5.80, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octane;octanoic acid is sourced from PubChem (CID 88924420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).