C17H34FeO4 — CID 56844011
iron;6-methylheptanoic acid;7-methyloctanoic acid (PubChem CID 56844011) has the molecular formula C17H34FeO4 and a molecular weight of 358.30 g/mol. Its IUPAC name is iron;6-methylheptanoic acid;7-methyloctanoic acid.
| Compound Name | iron;6-methylheptanoic acid;7-methyloctanoic acid |
|---|---|
| PubChem CID | 56844011 |
| Molecular Formula | C17H34FeO4 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | iron;6-methylheptanoic acid;7-methyloctanoic acid |
| SMILES | CC(C)CCCCC(=O)O.CC(C)CCCCCC(=O)O.[Fe] |
| InChI | InChI=1S/C9H18O2.C8H16O2.Fe/c1-8(2)6-4-3-5-7-9(10)11;1-7(2)5-3-4-6-8(9)10;/h8H,3-7H2,1-2H3,(H,10,11);7H,3-6H2,1-2H3,(H,9,10); |
| InChIKey | SUATTXBZMRVPDD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|