About sodium;hydride;6-methylheptanoic acid
sodium;hydride;6-methylheptanoic acid (PubChem CID 174475906) has the molecular formula C8H17NaO2
and a molecular weight of 168.21 g/mol. Its IUPAC name is sodium;hydride;6-methylheptanoic acid.
Molecular Properties
| Compound Name | sodium;hydride;6-methylheptanoic acid |
| PubChem CID | 174475906 |
| Molecular Formula | C8H17NaO2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | sodium;hydride;6-methylheptanoic acid |
| SMILES | CC(C)CCCCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C8H16O2.Na.H/c1-7(2)5-3-4-6-8(9)10;;/h7H,3-6H2,1-2H3,(H,9,10);;/q;+1;-1 |
| InChIKey | DILHJHNXMFEPHM-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;6-methylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;6-methylheptanoic acid?
The IUPAC name of sodium;hydride;6-methylheptanoic acid (CID 174475906) is sodium;hydride;6-methylheptanoic acid.
What is the SMILES notation for sodium;hydride;6-methylheptanoic acid?
The canonical SMILES for sodium;hydride;6-methylheptanoic acid is CC(C)CCCCC(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;6-methylheptanoic acid?
The InChIKey is DILHJHNXMFEPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.Na.H/c1-7(2)5-3-4-6-8(9)10;;/h7H,3-6H2,1-2H3,(H,9,10);;/q;+1;-1.
What are the key properties of sodium;hydride;6-methylheptanoic acid?
sodium;hydride;6-methylheptanoic acid has a molecular weight of 168.21 g/mol, XLogP of -0.60, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;6-methylheptanoic acid is sourced from PubChem (CID 174475906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).