C7H16N2U — CID 159962032
4-imino-N,N-dimethylpentan-1-amine;uranium (PubChem CID 159962032) has the molecular formula C7H16N2U and a molecular weight of 366.25 g/mol. Its IUPAC name is 4-imino-N,N-dimethylpentan-1-amine;uranium.
| Compound Name | 4-imino-N,N-dimethylpentan-1-amine;uranium |
|---|---|
| PubChem CID | 159962032 |
| Molecular Formula | C7H16N2U |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-imino-N,N-dimethylpentan-1-amine;uranium |
| SMILES | [H]/N=C(\C)CCCN(C)C.[U] |
| InChI | InChI=1S/C7H16N2.U/c1-7(8)5-4-6-9(2)3;/h8H,4-6H2,1-3H3;/b8-7+; |
| InChIKey | ODLMXEUHYKKVDP-USRGLUTNSA-N |
| XLogP | 1.37 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|