C8H15NO2 — CID 164832237
6-(dimethylamino)hexane-2,3-dione (PubChem CID 164832237) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 6-(dimethylamino)hexane-2,3-dione.
| Compound Name | 6-(dimethylamino)hexane-2,3-dione |
|---|---|
| PubChem CID | 164832237 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 6-(dimethylamino)hexane-2,3-dione |
| SMILES | CC(=O)C(=O)CCCN(C)C |
| InChI | InChI=1S/C8H15NO2/c1-7(10)8(11)5-4-6-9(2)3/h4-6H2,1-3H3 |
| InChIKey | GXCBZZSSRIUZOF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|