About 3-iminoheptanimidamide
3-iminoheptanimidamide (PubChem CID 158715697) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 3-iminoheptanimidamide.
Molecular Properties
| Compound Name | 3-iminoheptanimidamide |
| PubChem CID | 158715697 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 3-iminoheptanimidamide |
| SMILES | [H]/N=C(\N)C/C(CCCC)=N/[H] |
| InChI | InChI=1S/C7H15N3/c1-2-3-4-6(8)5-7(9)10/h8H,2-5H2,1H3,(H3,9,10)/b8-6+ |
| InChIKey | PHADQKMEFAZEHM-SOFGYWHQSA-N |
| XLogP | 1.52 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-iminoheptanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminoheptanimidamide?
The IUPAC name of 3-iminoheptanimidamide (CID 158715697) is 3-iminoheptanimidamide.
What is the SMILES notation for 3-iminoheptanimidamide?
The canonical SMILES for 3-iminoheptanimidamide is [H]/N=C(\N)C/C(CCCC)=N/[H].
What is the InChIKey of 3-iminoheptanimidamide?
The InChIKey is PHADQKMEFAZEHM-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H15N3/c1-2-3-4-6(8)5-7(9)10/h8H,2-5H2,1H3,(H3,9,10)/b8-6+.
What are the key properties of 3-iminoheptanimidamide?
3-iminoheptanimidamide has a molecular weight of 141.22 g/mol, XLogP of 1.52, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminoheptanimidamide is sourced from PubChem (CID 158715697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).