About N'-diazenylpentanimidamide
N'-diazenylpentanimidamide (PubChem CID 143625651) has the molecular formula C5H12N4
and a molecular weight of 128.18 g/mol. Its IUPAC name is N'-diazenylpentanimidamide.
Molecular Properties
| Compound Name | N'-diazenylpentanimidamide |
| PubChem CID | 143625651 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | N'-diazenylpentanimidamide |
| SMILES | [H]/N=N/N=C(N)CCCC |
| InChI | InChI=1S/C5H12N4/c1-2-3-4-5(6)8-9-7/h2-4H2,1H3,(H3,6,7,8) |
| InChIKey | AEKBLLVZZRIMAO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-diazenylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-diazenylpentanimidamide?
The IUPAC name of N'-diazenylpentanimidamide (CID 143625651) is N'-diazenylpentanimidamide.
What is the SMILES notation for N'-diazenylpentanimidamide?
The canonical SMILES for N'-diazenylpentanimidamide is [H]/N=N/N=C(N)CCCC.
What is the InChIKey of N'-diazenylpentanimidamide?
The InChIKey is AEKBLLVZZRIMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4/c1-2-3-4-5(6)8-9-7/h2-4H2,1H3,(H3,6,7,8).
What are the key properties of N'-diazenylpentanimidamide?
N'-diazenylpentanimidamide has a molecular weight of 128.18 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-diazenylpentanimidamide is sourced from PubChem (CID 143625651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).