About 6-N'-nitrosohexanediimidamide
6-N'-nitrosohexanediimidamide (PubChem CID 143800377) has the molecular formula C6H13N5O
and a molecular weight of 171.20 g/mol. Its IUPAC name is 6-N'-nitrosohexanediimidamide.
Molecular Properties
| Compound Name | 6-N'-nitrosohexanediimidamide |
| PubChem CID | 143800377 |
| Molecular Formula | C6H13N5O |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 6-N'-nitrosohexanediimidamide |
| SMILES | [H]/N=C(\N)CCCC/C(N)=N/N=O |
| InChI | InChI=1S/C6H13N5O/c7-5(8)3-1-2-4-6(9)10-11-12/h1-4H2,(H3,7,8)(H2,9,10,12) |
| InChIKey | YZDMYYUBNFQZBJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-N'-nitrosohexanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N'-nitrosohexanediimidamide?
The IUPAC name of 6-N'-nitrosohexanediimidamide (CID 143800377) is 6-N'-nitrosohexanediimidamide.
What is the SMILES notation for 6-N'-nitrosohexanediimidamide?
The canonical SMILES for 6-N'-nitrosohexanediimidamide is [H]/N=C(\N)CCCC/C(N)=N/N=O.
What is the InChIKey of 6-N'-nitrosohexanediimidamide?
The InChIKey is YZDMYYUBNFQZBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N5O/c7-5(8)3-1-2-4-6(9)10-11-12/h1-4H2,(H3,7,8)(H2,9,10,12).
What are the key properties of 6-N'-nitrosohexanediimidamide?
6-N'-nitrosohexanediimidamide has a molecular weight of 171.20 g/mol, XLogP of 0.52, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N'-nitrosohexanediimidamide is sourced from PubChem (CID 143800377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).