About 8-amino-8-iminooctanoic acid
8-amino-8-iminooctanoic acid (PubChem CID 139654610) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 8-amino-8-iminooctanoic acid.
Molecular Properties
| Compound Name | 8-amino-8-iminooctanoic acid |
| PubChem CID | 139654610 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 8-amino-8-iminooctanoic acid |
| SMILES | [H]/N=C(\N)CCCCCCC(=O)O |
| InChI | InChI=1S/C8H16N2O2/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H3,9,10)(H,11,12) |
| InChIKey | ZRCWNUCPGCSXEH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-8-iminooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-8-iminooctanoic acid?
The IUPAC name of 8-amino-8-iminooctanoic acid (CID 139654610) is 8-amino-8-iminooctanoic acid.
What is the SMILES notation for 8-amino-8-iminooctanoic acid?
The canonical SMILES for 8-amino-8-iminooctanoic acid is [H]/N=C(\N)CCCCCCC(=O)O.
What is the InChIKey of 8-amino-8-iminooctanoic acid?
The InChIKey is ZRCWNUCPGCSXEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H3,9,10)(H,11,12).
What are the key properties of 8-amino-8-iminooctanoic acid?
8-amino-8-iminooctanoic acid has a molecular weight of 172.23 g/mol, XLogP of 1.35, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-8-iminooctanoic acid is sourced from PubChem (CID 139654610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).